CAS 127590-90-3 appears in our catalog under these names: 5-(Benzyloxy)-2-(chloromethyl)pyridine, 95%, 5-(Benzyloxy)-2-(chloromethyl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-(chloromethyl)-5-phenylmethoxypyridine (CAS 127590-90-3) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 2-(chloromethyl)-5-phenylmethoxypyridine. InChIKey: CTWNTPDUEZHHNW-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 2-(chloromethyl)-5-phenylmethoxypyridine |
| InChIKey | CTWNTPDUEZHHNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CN=C(C=C2)CCl |
Computed by PubChem (NCBI)