CAS 56966-51-9 is the registry number for 5-Chloro-2-(3-methylphenoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-chloro-2-(3-methylphenoxy)aniline (CAS 56966-51-9) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 5-chloro-2-(3-methylphenoxy)aniline. InChIKey: KBUUENZGTGZADQ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 5-chloro-2-(3-methylphenoxy)aniline |
| InChIKey | KBUUENZGTGZADQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)