CAS 944445-41-4 appears in our catalog under these names: 3-(Benzyloxy)-2-(chloromethyl)pyridine, 95%, 3–(Benzyloxy)–2–(chloromethyl)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-(chloromethyl)-3-phenylmethoxypyridine (CAS 944445-41-4) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 2-(chloromethyl)-3-phenylmethoxypyridine. InChIKey: SAVDUNLFCYMROD-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 2-(chloromethyl)-3-phenylmethoxypyridine |
| InChIKey | SAVDUNLFCYMROD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)CCl |
Computed by PubChem (NCBI)