(2-(4-Ethylphenoxy)pyridin-3-yl)boronic acid, 95%
cas: 2089158-08-5 — see every product listed under this CAS number, including other names
(2-(4-Ethylphenoxy)pyridin-3-yl)boronic acid, 95% (CAS 2089158-08-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2289036-250mg |
| cas | 2089158-08-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1538.50 Pln | |
| Ambeed | 5g | 5243.12 Pln | |
| BLDpharm | 100mg | 392.11 Pln | |
| BLDpharm | 250mg | 614.25 Pln | |
| BLDpharm | 1g | 1513.94 Pln | |
| BLDpharm | 5g | 5140.44 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1226.00 Pln | |
| Chemat | 5g | 4134.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[2-(4-ethylphenoxy)-3-pyridinyl]boronic acid (CAS 2089158-08-5) is a chemical compound with the molecular formula C13H14BNO3 and a molecular weight of 243.07 g/mol. IUPAC name: [2-(4-ethylphenoxy)-3-pyridinyl]boronic acid. InChIKey: UYVZMSSNGVPEGN-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO3 |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | [2-(4-ethylphenoxy)-3-pyridinyl]boronic acid |
| InChIKey | UYVZMSSNGVPEGN-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OC2=CC=C(C=C2)CC)(O)O |
Computed by PubChem (NCBI)