CAS 2096336-17-1 appears in our catalog under these names: 6-(Benzyloxy)-2-methylpyridine-3-boronic acid, 95%, (6-(Benzyloxy)-2-methylpyridin-3-yl)boronic acid, 97%, 6-(Benzyloxy)-2-methylpyridine-3-boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 10g.
(2-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid (CAS 2096336-17-1) is a chemical compound with the molecular formula C13H14BNO3 and a molecular weight of 243.07 g/mol. IUPAC name: (2-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: JAJYOZGGBIHFAI-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO3 |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | (2-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid |
| InChIKey | JAJYOZGGBIHFAI-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)