Products 1451391-35-7

CAS 1451391-35-7 is the registry number for 6-(Benzyloxy)-4-methylpyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

(4-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid (CAS 1451391-35-7) is a chemical compound with the molecular formula C13H14BNO3 and a molecular weight of 243.07 g/mol. IUPAC name: (4-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: WOAURPRIQZGXGA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BNO3
Molecular weight243.07 g/mol
IUPAC name(4-methyl-6-phenylmethoxy-3-pyridinyl)boronic acid
InChIKeyWOAURPRIQZGXGA-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1C)OCC2=CC=CC=C2)(O)O

Computed by PubChem (NCBI)