Products 2096330-16-2

CAS 2096330-16-2 is the registry number for 2-Benzyloxy-5-methylpyridine-3-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(5-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid (CAS 2096330-16-2) is a chemical compound with the molecular formula C13H14BNO3 and a molecular weight of 243.07 g/mol. IUPAC name: (5-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: NVGSTMYZWMKVPE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BNO3
Molecular weight243.07 g/mol
IUPAC name(5-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid
InChIKeyNVGSTMYZWMKVPE-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OCC2=CC=CC=C2)C)(O)O

Computed by PubChem (NCBI)