cas: 1311159-02-0 — see every product listed under this CAS number, including other names
(2-(Cyclopentyloxy)phenyl)boronic acid 98% (CAS 1311159-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A685923-100mg |
| cas | 1311159-02-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A685923 |
(2-cyclopentyloxyphenyl)boronic acid (CAS 1311159-02-0) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: (2-cyclopentyloxyphenyl)boronic acid. InChIKey: WGINBVBPTCTQOQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | (2-cyclopentyloxyphenyl)boronic acid |
| InChIKey | WGINBVBPTCTQOQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OC2CCCC2)(O)O |
Computed by PubChem (NCBI)