(2-(Ethoxycarbonyl)-5-fluorophenyl)boronic acid, 95%
cas: 957062-87-2 — see every product listed under this CAS number, including other names
(2-(Ethoxycarbonyl)-5-fluorophenyl)boronic acid, 95% (CAS 957062-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A747432-250mg |
| cas | 957062-87-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1182.50 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Fluorochem | 1g | 367.60 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 397.66 Pln | |
| BLDpharm | 5g | 1269.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2-ethoxycarbonyl-5-fluorophenyl)boronic acid (CAS 957062-87-2) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: (2-ethoxycarbonyl-5-fluorophenyl)boronic acid. InChIKey: DIHBRMAJVXAIOE-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | (2-ethoxycarbonyl-5-fluorophenyl)boronic acid |
| InChIKey | DIHBRMAJVXAIOE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-(Ethoxycarbonyl)-5-fluorophenyl)boronic acid, 2-Ethoxycabonyl-5-fluorophenylboronic acid, (2-ethoxycarbonyl-5-fluorophenyl)boronic acid, [2-(Ethoxycarbonyl)-5-fluorophenyl]boronic acid, (2-ethoxycarbonyl-5-fluoro-phenyl)boronic acid, 2-(Ethoxycarbonyl)-5-fluorobenzeneboronic acid, 2-(ethoxycarbonyl)-5-fluorophenylboronic acid, (2-(Ethoxycarbonyl)-5-fluorophenyl)boronicacid