Products 2828446-97-3
CAS 2828446-97-3 is the registry number for (3-Fluoro-5-(methoxycarbonyl)-2-methylphenyl)boronic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
(3-fluoro-5-methoxycarbonyl-2-methylphenyl)boronic acid (CAS 2828446-97-3) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: (3-fluoro-5-methoxycarbonyl-2-methylphenyl)boronic acid. InChIKey: CRFPAOLDBQTBBC-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | (3-fluoro-5-methoxycarbonyl-2-methylphenyl)boronic acid |
| InChIKey | CRFPAOLDBQTBBC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)