Products 1318768-59-0
CAS 1318768-59-0 is the registry number for [2-Fluoro-5-(2-methoxy-2-oxoethyl)phenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-fluoro-5-(2-methoxy-2-oxoethyl)phenyl]boronic acid (CAS 1318768-59-0) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: [2-fluoro-5-(2-methoxy-2-oxoethyl)phenyl]boronic acid. InChIKey: SZLUHTYVOZFRIL-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | [2-fluoro-5-(2-methoxy-2-oxoethyl)phenyl]boronic acid |
| InChIKey | SZLUHTYVOZFRIL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CC(=O)OC)F)(O)O |
Computed by PubChem (NCBI)