CAS 874288-38-7 appears in our catalog under these names: 4–Ethoxycarbonyl–3–fluorophenylboronic acid, 4-(Ethoxycarbonyl)-3-fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-Ethoxycarbonyl-3-fluorophenylboronic acid 97%, 4-Ethoxycarbonyl-3-fluorophenylboronic acid, 98%, 98%, 4-Ethoxycarbonyl-3-fluorophenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 10g.
(4-ethoxycarbonyl-3-fluorophenyl)boronic acid (CAS 874288-38-7) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: (4-ethoxycarbonyl-3-fluorophenyl)boronic acid. InChIKey: CXSPPZZTTSHTMP-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | (4-ethoxycarbonyl-3-fluorophenyl)boronic acid |
| InChIKey | CXSPPZZTTSHTMP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OCC)F)(O)O |
Computed by PubChem (NCBI)