cas: 632325-51-0 — see every product listed under this CAS number, including other names
(2-(Ethoxycarbonyl)thiophen-3-yl)boronic acid, 98% (CAS 632325-51-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1501234-25g |
| cas | 632325-51-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 45262.42 Pln | |
| AmBeed | 5g | 13610.80 Pln | |
| AmBeed | 10g | 23089.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-ethoxycarbonylthiophen-3-yl)boronic acid (CAS 632325-51-0) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (2-ethoxycarbonylthiophen-3-yl)boronic acid. InChIKey: AZLKJXPIJBJJFG-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (2-ethoxycarbonylthiophen-3-yl)boronic acid |
| InChIKey | AZLKJXPIJBJJFG-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC=C1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)