CAS 1256345-70-6 is the registry number for 5-(Methoxycarbonyl)-4-methylthiophene-2-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(5-methoxycarbonyl-4-methylthiophen-2-yl)boronic acid (CAS 1256345-70-6) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (5-methoxycarbonyl-4-methylthiophen-2-yl)boronic acid. InChIKey: NRPWDFPOXWSQEO-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (5-methoxycarbonyl-4-methylthiophen-2-yl)boronic acid |
| InChIKey | NRPWDFPOXWSQEO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(S1)C(=O)OC)C)(O)O |
Computed by PubChem (NCBI)