CAS 1093120-64-9 appears in our catalog under these names: 5-Ethoxycarbonylthiophen-2-boronic acid, 95%, (5–(Ethoxycarbonyl)thiophen–2–yl)boronic acid, (5-Ethoxycarbonylthiophen-2-Yl)Boronic Acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
(5-ethoxycarbonylthiophen-2-yl)boronic acid (CAS 1093120-64-9) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (5-ethoxycarbonylthiophen-2-yl)boronic acid. InChIKey: QEBDDYBJDARVJR-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (5-ethoxycarbonylthiophen-2-yl)boronic acid |
| InChIKey | QEBDDYBJDARVJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)