Products 149104-88-1
CAS 149104-88-1 appears in our catalog under these names: 4–(Methanesulfonyl)phenylboronic acid, 4-(Methylsulfonyl)phenylboronic Acid (contains varying amounts of Anhydride), 4-(Methanesulfonyl)phenylboronic acid, 98+%, 4-(Methylsulfonyl)phenylboronic acid 98%, 4-(METHANESULFONYL)PHENYLBORONIC ACID, &. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 1000g, 25g, 100g, 500g, 250g.
(4-methylsulfonylphenyl)boronic acid (CAS 149104-88-1) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (4-methylsulfonylphenyl)boronic acid. InChIKey: VDUKDQTYMWUSAC-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (4-methylsulfonylphenyl)boronic acid |
| InChIKey | VDUKDQTYMWUSAC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Methanesulfonyl)phenylboronic acid, 4-(Methylsulfonyl)phenylboronic acid, (4-(methylsulfonyl)phenyl)boronic acid, 4-Methylsulfonylphenylboronic acid, (4-methylsulfonylphenyl)boronic Acid, 4-(Methanesulfonyl)benzeneboronic Acid, (4-methanesulfonylphenyl)boronic acid, 4-phenyl sulfone acid, 4-methylsulfonyl phenylboronic acid, 4-methylsulfonyl-phenyl boronic acid