cas: 133115-76-1 — see every product listed under this CAS number, including other names
(2-(Trifluoromethoxy)phenyl)hydrazine hydrochloride 95% (CAS 133115-76-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174905-1g |
| cas | 133115-76-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 1065.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174905 |
[2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride (CAS 133115-76-1) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride. InChIKey: HKJKYLCWAFIGNL-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride |
| InChIKey | HKJKYLCWAFIGNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)