Products 2231675-51-5
CAS 2231675-51-5 is the registry number for (4-(Difluoromethoxy)-5-fluoropyridin-2-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
[4-(difluoromethoxy)-5-fluoro-2-pyridinyl]methanamine;hydrochloride (CAS 2231675-51-5) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [4-(difluoromethoxy)-5-fluoro-2-pyridinyl]methanamine;hydrochloride. InChIKey: CJCPRWSKLZHPGG-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [4-(difluoromethoxy)-5-fluoro-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | CJCPRWSKLZHPGG-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=C1OC(F)F)F)CN.Cl |
Computed by PubChem (NCBI)