CAS 1431964-68-9 appears in our catalog under these names: 2-(2,2,2-Trifluoroethoxy)pyridin-3-amine hydrochloride, 95%, 2-(2,2,2-Trifluoroethoxy)pyridin-3-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
2-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride (CAS 1431964-68-9) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride. InChIKey: RQRROXBRQFYYBT-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride |
| InChIKey | RQRROXBRQFYYBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)