cas: 133115-76-1 — see every product listed under this CAS number, including other names
(2-(Trifluoromethoxy)phenyl)hydrazine hydrochloride, 97%, 97% (CAS 133115-76-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125AT-250mg |
| cas | 133115-76-1 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 837.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride (CAS 133115-76-1) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride. InChIKey: HKJKYLCWAFIGNL-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [2-(trifluoromethoxy)phenyl]hydrazine;hydrochloride |
| InChIKey | HKJKYLCWAFIGNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)