CAS 175278-07-6 appears in our catalog under these names: 2–(Trifluoromethoxy)benzyl Alcohol, 2-(Trifluoromethoxy)benzyl Alcohol, >96.0%(GC), (2-(Trifluoromethoxy)phenyl)methanol, 97%, 97%, 2-(Trifluoromethoxy)benzyl alcohol, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
[2-(trifluoromethoxy)phenyl]methanol (CAS 175278-07-6) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: [2-(trifluoromethoxy)phenyl]methanol. InChIKey: ICOVMLDFMWLRJO-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | [2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | ICOVMLDFMWLRJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)OC(F)(F)F |
Computed by PubChem (NCBI)