CAS 349-67-7 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethyl)phenol, 98%, 2–Methoxy–5–(trifluoromethyl)phenol, 2-Methoxy-5-(trifluoromethyl)phenol 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
2-methoxy-5-(trifluoromethyl)phenol (CAS 349-67-7) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)phenol. InChIKey: CHTWPKLLBRDFNP-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)phenol |
| InChIKey | CHTWPKLLBRDFNP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)