CAS 658062-74-9 appears in our catalog under these names: 3-(2,2,2-Trifluoroethoxy)phenol, 95%, 3-(2,2,2-Trifluoroethoxy)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
3-(2,2,2-trifluoroethoxy)phenol (CAS 658062-74-9) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)phenol. InChIKey: PZZNHAZMDITYQC-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)phenol |
| InChIKey | PZZNHAZMDITYQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)O |
Computed by PubChem (NCBI)