CAS 106877-41-2 is the registry number for 3-Methoxy-4-(trifluoromethyl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
3-methoxy-4-(trifluoromethyl)phenol (CAS 106877-41-2) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 3-methoxy-4-(trifluoromethyl)phenol. InChIKey: VWNDFOHZRDLUQY-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 3-methoxy-4-(trifluoromethyl)phenol |
| InChIKey | VWNDFOHZRDLUQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)O)C(F)(F)F |
Computed by PubChem (NCBI)