cas: 98451-51-5 — see every product listed under this CAS number, including other names
(2-Amino-6-nitrophenyl)methanol, 95%, 95% (CAS 98451-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1179C2-100mg |
| cas | 98451-51-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1691.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-amino-6-nitrophenyl)methanol (CAS 98451-51-5) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: (2-amino-6-nitrophenyl)methanol. InChIKey: BSQXKAWQRQDMAK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | (2-amino-6-nitrophenyl)methanol |
| InChIKey | BSQXKAWQRQDMAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])CO)N |
Computed by PubChem (NCBI)