CAS 22293-60-3 is the registry number for 5-Acetyl-6-methylpyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-acetyl-6-methyl-1H-pyrimidine-2,4-dione (CAS 22293-60-3) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 5-acetyl-6-methyl-1H-pyrimidine-2,4-dione. InChIKey: YVGRMDHVDOHDAF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 5-acetyl-6-methyl-1H-pyrimidine-2,4-dione |
| InChIKey | YVGRMDHVDOHDAF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=O)N1)C(=O)C |
Computed by PubChem (NCBI)