CAS 2096338-76-8 appears in our catalog under these names: 2-Bromo-3-fluoropyridine-4-boronic acid, 96%, 2-Bromo-3-fluoropyridine-4-boronic acid, 98%, 98%, (2-Bromo-3-fluoropyridin-4-yl)boronic acid, 98%, (2-Bromo-3-fluoropyridin-4-yl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(2-bromo-3-fluoro-4-pyridinyl)boronic acid (CAS 2096338-76-8) is a chemical compound with the molecular formula C5H4BBrFNO2 and a molecular weight of 219.81 g/mol. IUPAC name: (2-bromo-3-fluoro-4-pyridinyl)boronic acid. InChIKey: IWOCBRCHUQDPLK-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrFNO2 |
|---|---|
| Molecular weight | 219.81 g/mol |
| IUPAC name | (2-bromo-3-fluoro-4-pyridinyl)boronic acid |
| InChIKey | IWOCBRCHUQDPLK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)Br)F)(O)O |
Computed by PubChem (NCBI)