CAS 1150114-79-6 is the registry number for 3-Bromo-2-fluoropyridine-4-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-bromo-2-fluoro-4-pyridinyl)boronic acid (CAS 1150114-79-6) is a chemical compound with the molecular formula C5H4BBrFNO2 and a molecular weight of 219.81 g/mol. IUPAC name: (3-bromo-2-fluoro-4-pyridinyl)boronic acid. InChIKey: ILVIZHJYIXNWBE-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrFNO2 |
|---|---|
| Molecular weight | 219.81 g/mol |
| IUPAC name | (3-bromo-2-fluoro-4-pyridinyl)boronic acid |
| InChIKey | ILVIZHJYIXNWBE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)F)Br)(O)O |
Computed by PubChem (NCBI)