CAS 910649-58-0 appears in our catalog under these names: 6-Bromo-2-fluoropyridine-3-boronic acid, 98%, (6–Bromo–2–fluoropyridin–3–yl)boronic acid, (6-Bromo-2-fluoropyridin-3-yl)boronic acid 98%, (6-bromo-2-fluoropyridin-3-yl)boronic acid, 98%, 98%, (6-Bromo-2-fluoropyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
(6-bromo-2-fluoro-3-pyridinyl)boronic acid (CAS 910649-58-0) is a chemical compound with the molecular formula C5H4BBrFNO2 and a molecular weight of 219.81 g/mol. IUPAC name: (6-bromo-2-fluoro-3-pyridinyl)boronic acid. InChIKey: YUGZMJMNGRGYRZ-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrFNO2 |
|---|---|
| Molecular weight | 219.81 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | YUGZMJMNGRGYRZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)F)(O)O |
Computed by PubChem (NCBI)