CAS 2225176-29-2 is the registry number for 2–Fluoro–6–bromopyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-bromo-6-fluoro-4-pyridinyl)boronic acid (CAS 2225176-29-2) is a chemical compound with the molecular formula C5H4BBrFNO2 and a molecular weight of 219.81 g/mol. IUPAC name: (2-bromo-6-fluoro-4-pyridinyl)boronic acid. InChIKey: ACFPEVAMVHUJCW-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrFNO2 |
|---|---|
| Molecular weight | 219.81 g/mol |
| IUPAC name | (2-bromo-6-fluoro-4-pyridinyl)boronic acid |
| InChIKey | ACFPEVAMVHUJCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)F)(O)O |
Computed by PubChem (NCBI)