(2-Bromo-4-fluorophenyl)boronic acid, 98%
cas: 1217501-12-6 — see every product listed under this CAS number, including other names
(2-Bromo-4-fluorophenyl)boronic acid, 98% (CAS 1217501-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F619020-250MG |
| cas | 1217501-12-6 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 830.98 Pln | |
| Fluorochem | 25g | 1965.99 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 10g | 1099.06 Pln | |
| Ambeed | 25g | 2122.56 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 434.00 Pln | |
| Chemat | 10g | 707.60 Pln | |
| Chemat | 25g | 1346.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2-bromo-4-fluorophenyl)boronic acid (CAS 1217501-12-6) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-4-fluorophenyl)boronic acid. InChIKey: BHXVZYJULSWULU-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-4-fluorophenyl)boronic acid |
| InChIKey | BHXVZYJULSWULU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)Br)(O)O |
Computed by PubChem (NCBI)