cas: 1217501-12-6 — see every product listed under this CAS number, including other names
(2-Bromo-4-fluorophenyl)boronic acid, 98% (CAS 1217501-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619020-250MG |
| cas | 1217501-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 789.32 Pln | |
| Fluorochem | 25g | 1893.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-4-fluorophenyl)boronic acid (CAS 1217501-12-6) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-4-fluorophenyl)boronic acid. InChIKey: BHXVZYJULSWULU-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-4-fluorophenyl)boronic acid |
| InChIKey | BHXVZYJULSWULU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)Br)(O)O |
Computed by PubChem (NCBI)