Products 352535-97-8
CAS 352535-97-8 appears in our catalog under these names: 3-Bromo-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), (3-Bromo-2-fluorophenyl)boronic acid 95%, (3-Bromo-2-fluorophenyl)boronic acid 98+%, (3-Bromo-2-fluorophenyl)boronic acid, 95%, 95%, (3-Bromo-2-fluorophenyl)boronic acid, 95%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
(3-bromo-2-fluorophenyl)boronic acid (CAS 352535-97-8) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (3-bromo-2-fluorophenyl)boronic acid. InChIKey: QCLOSORNRRMFIA-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (3-bromo-2-fluorophenyl)boronic acid |
| InChIKey | QCLOSORNRRMFIA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-bromo-2-fluorophenyl)boronic acid, 3-Bromo-2-fluorophenylboronic acid, 2-Fluoro-3-bromophenylboronic acid, (3-Bromo-2-fluoro-phenyl)boronic acid, 3-Bromo-2-fluorobenzeneboronic Acid, 3-Bromo-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 3-Bromo-2-fluorophenylboronic acid(contains varying amounts of Anhydride), QCLOSORNRRMFIA-UHFFFAOYSA-N, (3-bromo-2-fluorophenyl)boronicacid, 3-bromo-2-fluoro-phenylboronic acid