(2-Bromo-6-fluoro-3-methoxyphenyl)boronic acid, 98%
cas: 957062-89-4 — see every product listed under this CAS number, including other names
(2-Bromo-6-fluoro-3-methoxyphenyl)boronic acid, 98% (CAS 957062-89-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A318531-1g |
| cas | 957062-89-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1182.50 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 197.73 Pln | |
| BLDpharm | 25g | 469.86 Pln | |
| BLDpharm | 100g | 1269.58 Pln | |
| Fluorochem | 25g | 445.69 Pln | |
| Fluorochem | 100g | 1216.26 Pln | |
| Fluorochem | 5g | 180.16 Pln | |
| Fluorochem | 10g | 299.91 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-bromo-6-fluoro-3-methoxyphenyl)boronic acid (CAS 957062-89-4) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (2-bromo-6-fluoro-3-methoxyphenyl)boronic acid. InChIKey: WCXHRSAUPYPWHO-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | WCXHRSAUPYPWHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-6-fluoro-3-methoxyphenylboronic acid, (2-bromo-6-fluoro-3-methoxyphenyl)boronic acid, 2-Bromo-6-fluoro-3-methoxybenzeneboronic acid, (2-bromo-6-fluoro-3-methoxy-phenyl)boronic acid, 2-Bromo-3-methoxy-6-fluorophenylboronic acid, (2-Bromo-6-fluoro-3-methoxyphenyl)boronicacid, Boronic acid, B-(2-bromo-6-fluoro-3-methoxyphenyl)-