cas: 957062-89-4 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoro-3-methoxyphenylboronic acid, 98%, 98% (CAS 957062-89-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BLZ-1g |
| cas | 957062-89-4 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1485.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-6-fluoro-3-methoxyphenyl)boronic acid (CAS 957062-89-4) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (2-bromo-6-fluoro-3-methoxyphenyl)boronic acid. InChIKey: WCXHRSAUPYPWHO-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | WCXHRSAUPYPWHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)OC)F)(O)O |
Computed by PubChem (NCBI)