cas: 936220-75-6 — see every product listed under this CAS number, including other names
(2-Chloro-3-(trifluoromethyl)phenyl)hydrazine hydrochloride, 95% (CAS 936220-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982979-100MG |
| cas | 936220-75-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1388.07 Pln | |
| Fluorochem | 250mg | 1976.41 Pln | |
| Fluorochem | 1g | 3678.93 Pln | |
| Fluorochem | 2.5g | 7240.18 Pln | |
| Fluorochem | 5g | 10702.50 Pln | |
| Fluorochem | 10g | 16132.88 Pln | |
| Chemat | 100mg | 1082.00 Pln | |
| Chemat | 250mg | 1552.40 Pln | |
| Chemat | 1g | 2162.00 Pln | |
| Chemat | 5g | 7254.80 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
[2-chloro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 936220-75-6) is a chemical compound with the molecular formula C7H7Cl2F3N2 and a molecular weight of 247.04 g/mol. IUPAC name: [2-chloro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: HUEJHEIKINJLKH-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F3N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | [2-chloro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | HUEJHEIKINJLKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)NN)Cl)C(F)(F)F.Cl |
Computed by PubChem (NCBI)