Products 2089671-65-6
CAS 2089671-65-6 appears in our catalog under these names: (R)–1–(3–Chloropyridin–2–yl)–2，2，2–trifluoroethanamine hydrochloride, (R)-1-(3-Chloropyridin-2-yl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(3-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 2089671-65-6) is a chemical compound with the molecular formula C7H7Cl2F3N2 and a molecular weight of 247.04 g/mol. IUPAC name: (1R)-1-(3-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: GFJXDXGNLCJUQU-FYZOBXCZSA-N.
| Molecular formula | C7H7Cl2F3N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | (1R)-1-(3-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | GFJXDXGNLCJUQU-FYZOBXCZSA-N |
| SMILES | C1=CC(=C(N=C1)[C@H](C(F)(F)F)N)Cl.Cl |
Computed by PubChem (NCBI)