CAS 299163-40-9 appears in our catalog under these names: (2-Chloro-5-(trifluoromethyl)phenyl)hydrazine hydrochloride, 97%, (2-Chloro-5-(trifluoromethyl)phenyl)hydrazine hydrochloride, (2-Chloro-5-(trifluoromethyl)phenyl)hydrazine hydrochloride, 97%, 97%, [2-chloro-5-(trifluoromethyl)phenyl]hydrazine hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 100mg, 250mg, 1g, 2.5g.
[2-chloro-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 299163-40-9) is a chemical compound with the molecular formula C7H7Cl2F3N2 and a molecular weight of 247.04 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: FRLINAXMXPSHSI-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F3N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | FRLINAXMXPSHSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NN)Cl.Cl |
Computed by PubChem (NCBI)