cas: 39226-96-5 — see every product listed under this CAS number, including other names
(2-Chloro-3-(trifluoromethyl)phenyl)methanamine, 95%, 95% (CAS 39226-96-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C89E-250mg |
| cas | 39226-96-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1048.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2-chloro-3-(trifluoromethyl)phenyl]methanamine (CAS 39226-96-5) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: [2-chloro-3-(trifluoromethyl)phenyl]methanamine. InChIKey: GRFVQNWTQVWNBY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | [2-chloro-3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | GRFVQNWTQVWNBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)Cl)CN |
Computed by PubChem (NCBI)