Products 65686-86-4
CAS 65686-86-4 appears in our catalog under these names: 1-(4-Chlorophenyl)-2,2,2-trifluoroethanamine, 97%, 1-(4-Chlorophenyl)-2,2,2-trifluoroethanamine, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 500mg.
1-(4-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 65686-86-4) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZGFGADXCVWZZHD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZGFGADXCVWZZHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)