CAS 361393-93-3 appears in our catalog under these names: 3-Chloro-4-(trifluoromethyl)benzylamine, 95%, 3–Chloro–4–(Trifluoromethyl)Benzyl Amine, (3-Chloro-4-(trifluoromethyl)phenyl)methanamine 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
[3-chloro-4-(trifluoromethyl)phenyl]methanamine (CAS 361393-93-3) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: [3-chloro-4-(trifluoromethyl)phenyl]methanamine. InChIKey: GRCRXCBPWHSEOI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | GRCRXCBPWHSEOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)Cl)C(F)(F)F |
Computed by PubChem (NCBI)