CAS 22753-82-8 appears in our catalog under these names: 4-Chloro-n-(2,2,2-trifluoroethyl)aniline, 95%, 4-Chloro-N-(2,2,2-trifluoroethyl)aniline, 97%, 4-Chloro-N-(2,2,2-trifluoroethyl)aniline, 4-Chloro-N-(2,2,2-trifluoroethyl)aniline, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g, 0,25g, 500mg.
4-chloro-N-(2,2,2-trifluoroethyl)aniline (CAS 22753-82-8) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 4-chloro-N-(2,2,2-trifluoroethyl)aniline. InChIKey: IPGVRHNLRNFLOP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 4-chloro-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | IPGVRHNLRNFLOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCC(F)(F)F)Cl |
Computed by PubChem (NCBI)