cas: 2225176-58-7 — see every product listed under this CAS number, including other names
(2-Chloro-6-fluoropyridin-4-yl)boronic acid, 95+%, 95+% (CAS 2225176-58-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch138874-100mg |
| cas | 2225176-58-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-6-fluoro-4-pyridinyl)boronic acid (CAS 2225176-58-7) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (2-chloro-6-fluoro-4-pyridinyl)boronic acid. InChIKey: QULJTMKFOLWEFS-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (2-chloro-6-fluoro-4-pyridinyl)boronic acid |
| InChIKey | QULJTMKFOLWEFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)