CAS 1366482-32-7 appears in our catalog under these names: (5-Chloro-6-fluoropyridin-3-yl)boronic acid 98%, (5-Chloro-6-fluoropyridin-3-yl)boronic acid, 98%, 98%, 5-CHLORO-6-FLUOROPYRIDIN-3-YLBORONIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
(5-chloro-6-fluoro-3-pyridinyl)boronic acid (CAS 1366482-32-7) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (5-chloro-6-fluoro-3-pyridinyl)boronic acid. InChIKey: YYFMQBOVWLWZQO-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (5-chloro-6-fluoro-3-pyridinyl)boronic acid |
| InChIKey | YYFMQBOVWLWZQO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)Cl)(O)O |
Computed by PubChem (NCBI)