CAS 1256345-66-0 appears in our catalog under these names: (6–Chloro–2–fluoropyridin–3–yl)boronic acid, 6-Chloro-2-fluoropyridine-3-boronic acid, (6-Chloro-2-fluoropyridin-3-yl)boronic acid 98%, (6-Chloro-2-Fluoropyridin-3-Yl)Boronic Acid, 98%, 98%, (6-Chloro-2-fluoropyridin-3-yl)boronic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 500mg, 100mg, 10g, 25g.
(6-chloro-2-fluoro-3-pyridinyl)boronic acid (CAS 1256345-66-0) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (6-chloro-2-fluoro-3-pyridinyl)boronic acid. InChIKey: AYPTVURLQVNETR-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | AYPTVURLQVNETR-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)