Products 1072946-66-7
CAS 1072946-66-7 appears in our catalog under these names: 2-Chloro-3-fluoropyridine-5-boronic acid, 96%, (6-Chloro-5-fluoropyridin-3-yl)boronic acid 95%, (6-Chloro-5-fluoropyridin-3-yl)boronic acid, 97%, 97%, (6-Chloro-5-fluoropyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 500mg, 10g, 50g.
(6-chloro-5-fluoro-3-pyridinyl)boronic acid (CAS 1072946-66-7) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (6-chloro-5-fluoro-3-pyridinyl)boronic acid. InChIKey: NWEKVQKALFWZHQ-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (6-chloro-5-fluoro-3-pyridinyl)boronic acid |
| InChIKey | NWEKVQKALFWZHQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)