cas: 1094301-19-5 — see every product listed under this CAS number, including other names
(2-Chloro-pyridin-3-yl)-(4-hydroxymethyl-piperidin-1-yl)-methanone, 95% (CAS 1094301-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088994-100MG |
| cas | 1094301-19-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 3111.42 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone (CAS 1094301-19-5) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: (2-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone. InChIKey: AZYJAPJMNUQTSL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | (2-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| InChIKey | AZYJAPJMNUQTSL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CO)C(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)