CAS 30163-89-4 appears in our catalog under these names: 3-(5,6-Dimethyl-1h-benzo[d]imidazol-1-yl)propanoic acid hydrochloride, 95%, 3-(5,6-Dimethyl-1H-benzo(d)imidazol-1-yl)propanoic acid hydrochloride, 97%, 3-(5,6-Dimethyl-1H-1,3-benzodiazol-1-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
3-(5,6-dimethylbenzimidazol-1-yl)propanoic acid;hydrochloride (CAS 30163-89-4) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 3-(5,6-dimethylbenzimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: DPTKBJFCXLNQGG-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 3-(5,6-dimethylbenzimidazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | DPTKBJFCXLNQGG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CCC(=O)O.Cl |
Computed by PubChem (NCBI)