(2-Fluoro-3-methoxypyridin-4-yl)boronic acid, 97%, 97%
cas: 1451392-01-0 — see every product listed under this CAS number, including other names
(2-Fluoro-3-methoxypyridin-4-yl)boronic acid, 97%, 97% (CAS 1451392-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129Q08-100mg |
| cas | 1451392-01-0 |
| size | 100mg |
| availability | 0.75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 794.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-fluoro-3-methoxy-4-pyridinyl)boronic acid (CAS 1451392-01-0) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (2-fluoro-3-methoxy-4-pyridinyl)boronic acid. InChIKey: XJHXSDGMVPHYJZ-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (2-fluoro-3-methoxy-4-pyridinyl)boronic acid |
| InChIKey | XJHXSDGMVPHYJZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)F)OC)(O)O |
Computed by PubChem (NCBI)