cas: 344411-08-1 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(trifluoromethoxy)phenyl)methanol 96% (CAS 344411-08-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741551-250mg |
| cas | 344411-08-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Ambeed | 10g | 1722.06 Pln | |
| Ambeed | 25g | 3535.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A741551 |
[2-fluoro-5-(trifluoromethoxy)phenyl]methanol (CAS 344411-08-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethoxy)phenyl]methanol. InChIKey: BOTUFOKWIHWOKF-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | BOTUFOKWIHWOKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CO)F |
Computed by PubChem (NCBI)