cas: 344411-08-1 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(trifluoromethoxy)phenyl)methanol, 96%, 96% (CAS 344411-08-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CA3U-250mg |
| cas | 344411-08-1 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 5g | 918.80 Pln | |
| Chemat | 10g | 1509.20 Pln | |
| Chemat | 25g | 1965.20 Pln | |
| Chemat | 1g | 352.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[2-fluoro-5-(trifluoromethoxy)phenyl]methanol (CAS 344411-08-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethoxy)phenyl]methanol. InChIKey: BOTUFOKWIHWOKF-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | BOTUFOKWIHWOKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CO)F |
Computed by PubChem (NCBI)